C10H17NS — CID 88985534
(3S)-N-methyl-4-methylidene-1-methylsulfanylhepta-5,6-dien-3-amine (PubChem CID 88985534) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is (3S)-N-methyl-4-methylidene-1-methylsulfanylhepta-5,6-dien-3-amine.
| Compound Name | (3S)-N-methyl-4-methylidene-1-methylsulfanylhepta-5,6-dien-3-amine |
|---|---|
| PubChem CID | 88985534 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | (3S)-N-methyl-4-methylidene-1-methylsulfanylhepta-5,6-dien-3-amine |
| SMILES | C=C=CC(=C)[C@H](CCSC)NC |
| InChI | InChI=1S/C10H17NS/c1-5-6-9(2)10(11-3)7-8-12-4/h6,10-11H,1-2,7-8H2,3-4H3/t10-/m0/s1 |
| InChIKey | FDPCQATVLLMGFZ-JTQLQIEISA-N |
| XLogP | 2.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|