C7H7NO2 — CID 87127669
N-prop-2-enoylbuta-2,3-dienamide (PubChem CID 87127669) has the molecular formula C7H7NO2 and a molecular weight of 137.14 g/mol. Its IUPAC name is N-prop-2-enoylbuta-2,3-dienamide.
| Compound Name | N-prop-2-enoylbuta-2,3-dienamide |
|---|---|
| PubChem CID | 87127669 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | N-prop-2-enoylbuta-2,3-dienamide |
| SMILES | C=C=CC(=O)NC(=O)C=C |
| InChI | InChI=1S/C7H7NO2/c1-3-5-7(10)8-6(9)4-2/h4-5H,1-2H2,(H,8,9,10) |
| InChIKey | XXQBGBUZLWZPKT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|