C11H13NO — CID 162528154
N-(4-ethenylhexa-1,3,5-trien-3-yl)prop-2-enamide (PubChem CID 162528154) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is N-(4-ethenylhexa-1,3,5-trien-3-yl)prop-2-enamide.
| Compound Name | N-(4-ethenylhexa-1,3,5-trien-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 162528154 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | N-(4-ethenylhexa-1,3,5-trien-3-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC(C=C)=C(C=C)C=C |
| InChI | InChI=1S/C11H13NO/c1-5-9(6-2)10(7-3)12-11(13)8-4/h5-8H,1-4H2,(H,12,13) |
| InChIKey | QMYZEYPERNTSKE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|