About N-hydroxyprop-2-enamide;hydrochloride
N-hydroxyprop-2-enamide;hydrochloride (PubChem CID 87262131) has the molecular formula C3H6ClNO2
and a molecular weight of 123.54 g/mol. Its IUPAC name is N-hydroxyprop-2-enamide;hydrochloride.
Molecular Properties
| Compound Name | N-hydroxyprop-2-enamide;hydrochloride |
| PubChem CID | 87262131 |
| Molecular Formula | C3H6ClNO2 |
| Molecular Weight | 123.54 g/mol |
| Exact Mass | 123.01 |
| IUPAC Name | N-hydroxyprop-2-enamide;hydrochloride |
| SMILES | C=CC(=O)NO.Cl |
| InChI | InChI=1S/C3H5NO2.ClH/c1-2-3(5)4-6;/h2,6H,1H2,(H,4,5);1H |
| InChIKey | PAFSJPQJSJMZKQ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.54 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxyprop-2-enamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxyprop-2-enamide;hydrochloride?
The IUPAC name of N-hydroxyprop-2-enamide;hydrochloride (CID 87262131) is N-hydroxyprop-2-enamide;hydrochloride.
What is the SMILES notation for N-hydroxyprop-2-enamide;hydrochloride?
The canonical SMILES for N-hydroxyprop-2-enamide;hydrochloride is C=CC(=O)NO.Cl.
What is the InChIKey of N-hydroxyprop-2-enamide;hydrochloride?
The InChIKey is PAFSJPQJSJMZKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO2.ClH/c1-2-3(5)4-6;/h2,6H,1H2,(H,4,5);1H.
What are the key properties of N-hydroxyprop-2-enamide;hydrochloride?
N-hydroxyprop-2-enamide;hydrochloride has a molecular weight of 123.54 g/mol, XLogP of 0.10, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxyprop-2-enamide;hydrochloride is sourced from PubChem (CID 87262131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).