About (Z)-2-ethenyl-N'-hydroxybut-2-enediamide
(Z)-2-ethenyl-N'-hydroxybut-2-enediamide (PubChem CID 123923721) has the molecular formula C6H8N2O3
and a molecular weight of 156.14 g/mol. Its IUPAC name is (Z)-2-ethenyl-N'-hydroxybut-2-enediamide.
Molecular Properties
| Compound Name | (Z)-2-ethenyl-N'-hydroxybut-2-enediamide |
| PubChem CID | 123923721 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | (Z)-2-ethenyl-N'-hydroxybut-2-enediamide |
| SMILES | C=C/C(=C/C(=O)NO)C(N)=O |
| InChI | InChI=1S/C6H8N2O3/c1-2-4(6(7)10)3-5(9)8-11/h2-3,11H,1H2,(H2,7,10)(H,8,9)/b4-3- |
| InChIKey | XQUKEJDGBPIPGI-ARJAWSKDSA-N |
| XLogP | -0.91 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-ethenyl-N'-hydroxybut-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-ethenyl-N'-hydroxybut-2-enediamide?
The IUPAC name of (Z)-2-ethenyl-N'-hydroxybut-2-enediamide (CID 123923721) is (Z)-2-ethenyl-N'-hydroxybut-2-enediamide.
What is the SMILES notation for (Z)-2-ethenyl-N'-hydroxybut-2-enediamide?
The canonical SMILES for (Z)-2-ethenyl-N'-hydroxybut-2-enediamide is C=C/C(=C/C(=O)NO)C(N)=O.
What is the InChIKey of (Z)-2-ethenyl-N'-hydroxybut-2-enediamide?
The InChIKey is XQUKEJDGBPIPGI-ARJAWSKDSA-N. The full InChI is InChI=1S/C6H8N2O3/c1-2-4(6(7)10)3-5(9)8-11/h2-3,11H,1H2,(H2,7,10)(H,8,9)/b4-3-.
What are the key properties of (Z)-2-ethenyl-N'-hydroxybut-2-enediamide?
(Z)-2-ethenyl-N'-hydroxybut-2-enediamide has a molecular weight of 156.14 g/mol, XLogP of -0.91, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-ethenyl-N'-hydroxybut-2-enediamide is sourced from PubChem (CID 123923721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).