About penta-1,4-dien-3-one;urea
penta-1,4-dien-3-one;urea (PubChem CID 88518142) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is penta-1,4-dien-3-one;urea.
Molecular Properties
| Compound Name | penta-1,4-dien-3-one;urea |
| PubChem CID | 88518142 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | penta-1,4-dien-3-one;urea |
| SMILES | C=CC(=O)C=C.NC(N)=O |
| InChI | InChI=1S/C5H6O.CH4N2O/c1-3-5(6)4-2;2-1(3)4/h3-4H,1-2H2;(H4,2,3,4) |
| InChIKey | HSTFOXOYMOSOGF-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze penta-1,4-dien-3-one;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of penta-1,4-dien-3-one;urea?
The IUPAC name of penta-1,4-dien-3-one;urea (CID 88518142) is penta-1,4-dien-3-one;urea.
What is the SMILES notation for penta-1,4-dien-3-one;urea?
The canonical SMILES for penta-1,4-dien-3-one;urea is C=CC(=O)C=C.NC(N)=O.
What is the InChIKey of penta-1,4-dien-3-one;urea?
The InChIKey is HSTFOXOYMOSOGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O.CH4N2O/c1-3-5(6)4-2;2-1(3)4/h3-4H,1-2H2;(H4,2,3,4).
What are the key properties of penta-1,4-dien-3-one;urea?
penta-1,4-dien-3-one;urea has a molecular weight of 142.16 g/mol, XLogP of -0.05, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for penta-1,4-dien-3-one;urea is sourced from PubChem (CID 88518142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).