About methane;penta-1,4-dien-3-one
methane;penta-1,4-dien-3-one (PubChem CID 174748125) has the molecular formula C7H14O
and a molecular weight of 114.19 g/mol. Its IUPAC name is methane;penta-1,4-dien-3-one.
Molecular Properties
| Compound Name | methane;penta-1,4-dien-3-one |
| PubChem CID | 174748125 |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | methane;penta-1,4-dien-3-one |
| SMILES | C.C.C=CC(=O)C=C |
| InChI | InChI=1S/C5H6O.2CH4/c1-3-5(6)4-2;;/h3-4H,1-2H2;2*1H4 |
| InChIKey | BMVYILGANFRYQR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methane;penta-1,4-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;penta-1,4-dien-3-one?
The IUPAC name of methane;penta-1,4-dien-3-one (CID 174748125) is methane;penta-1,4-dien-3-one.
What is the SMILES notation for methane;penta-1,4-dien-3-one?
The canonical SMILES for methane;penta-1,4-dien-3-one is C.C.C=CC(=O)C=C.
What is the InChIKey of methane;penta-1,4-dien-3-one?
The InChIKey is BMVYILGANFRYQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O.2CH4/c1-3-5(6)4-2;;/h3-4H,1-2H2;2*1H4.
What are the key properties of methane;penta-1,4-dien-3-one?
methane;penta-1,4-dien-3-one has a molecular weight of 114.19 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;penta-1,4-dien-3-one is sourced from PubChem (CID 174748125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).