C8H12N2O4 — CID 87214748
4,4-dihydroxy-2-methylidene-4-(prop-2-enoylamino)butanamide (PubChem CID 87214748) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 4,4-dihydroxy-2-methylidene-4-(prop-2-enoylamino)butanamide.
| Compound Name | 4,4-dihydroxy-2-methylidene-4-(prop-2-enoylamino)butanamide |
|---|---|
| PubChem CID | 87214748 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 4,4-dihydroxy-2-methylidene-4-(prop-2-enoylamino)butanamide |
| SMILES | C=CC(=O)NC(O)(O)CC(=C)C(N)=O |
| InChI | InChI=1S/C8H12N2O4/c1-3-6(11)10-8(13,14)4-5(2)7(9)12/h3,13-14H,1-2,4H2,(H2,9,12)(H,10,11) |
| InChIKey | BIQQTFCFRXJZAK-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|