C15H22N4O4 — CID 139534058
2,4-dimethylidenepentanediamide;N-[2-(prop-2-enoylamino)ethyl]prop-2-enamide (PubChem CID 139534058) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is 2,4-dimethylidenepentanediamide;N-[2-(prop-2-enoylamino)ethyl]prop-2-enamide.
| Compound Name | 2,4-dimethylidenepentanediamide;N-[2-(prop-2-enoylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 139534058 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2,4-dimethylidenepentanediamide;N-[2-(prop-2-enoylamino)ethyl]prop-2-enamide |
| SMILES | C=C(CC(=C)C(N)=O)C(N)=O.C=CC(=O)NCCNC(=O)C=C |
| InChI | InChI=1S/C8H12N2O2.C7H10N2O2/c1-3-7(11)9-5-6-10-8(12)4-2;1-4(6(8)10)3-5(2)7(9)11/h3-4H,1-2,5-6H2,(H,9,11)(H,10,12);1-3H2,(H2,8,10)(H2,9,11) |
| InChIKey | LVBNYASCSCXYCD-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|