C8H12N2O3 — CID 53437142
N'-(hydroxymethyl)-2,4-dimethylidenepentanediamide (PubChem CID 53437142) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is N'-(hydroxymethyl)-2,4-dimethylidenepentanediamide.
| Compound Name | N'-(hydroxymethyl)-2,4-dimethylidenepentanediamide |
|---|---|
| PubChem CID | 53437142 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | N'-(hydroxymethyl)-2,4-dimethylidenepentanediamide |
| SMILES | C=C(CC(=C)C(=O)NCO)C(N)=O |
| InChI | InChI=1S/C8H12N2O3/c1-5(7(9)12)3-6(2)8(13)10-4-11/h11H,1-4H2,(H2,9,12)(H,10,13) |
| InChIKey | QMWDUJXKNDJSLQ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|