About 2-(oxamoylamino)acetic acid
2-(oxamoylamino)acetic acid (PubChem CID 55281663) has the molecular formula C4H6N2O4
and a molecular weight of 146.10 g/mol. Its IUPAC name is 2-(oxamoylamino)acetic acid.
Molecular Properties
| Compound Name | 2-(oxamoylamino)acetic acid |
| PubChem CID | 55281663 |
| Molecular Formula | C4H6N2O4 |
| Molecular Weight | 146.10 g/mol |
| Exact Mass | 146.03 |
| IUPAC Name | 2-(oxamoylamino)acetic acid |
| SMILES | NC(=O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C4H6N2O4/c5-3(9)4(10)6-1-2(7)8/h1H2,(H2,5,9)(H,6,10)(H,7,8) |
| InChIKey | LIGRAMCSNNLRCN-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.10 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxamoylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxamoylamino)acetic acid?
The IUPAC name of 2-(oxamoylamino)acetic acid (CID 55281663) is 2-(oxamoylamino)acetic acid.
What is the SMILES notation for 2-(oxamoylamino)acetic acid?
The canonical SMILES for 2-(oxamoylamino)acetic acid is NC(=O)C(=O)NCC(=O)O.
What is the InChIKey of 2-(oxamoylamino)acetic acid?
The InChIKey is LIGRAMCSNNLRCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O4/c5-3(9)4(10)6-1-2(7)8/h1H2,(H2,5,9)(H,6,10)(H,7,8).
What are the key properties of 2-(oxamoylamino)acetic acid?
2-(oxamoylamino)acetic acid has a molecular weight of 146.10 g/mol, XLogP of -2.33, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxamoylamino)acetic acid is sourced from PubChem (CID 55281663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).