C8H14N4O4 — CID 144959900
2-[[2-[[2-(1-aminoethenylamino)acetyl]amino]acetyl]amino]acetic acid (PubChem CID 144959900) has the molecular formula C8H14N4O4 and a molecular weight of 230.22 g/mol. Its IUPAC name is 2-[[2-[[2-(1-aminoethenylamino)acetyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-(1-aminoethenylamino)acetyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 144959900 |
| Molecular Formula | C8H14N4O4 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 2-[[2-[[2-(1-aminoethenylamino)acetyl]amino]acetyl]amino]acetic acid |
| SMILES | C=C(N)NCC(=O)NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C8H14N4O4/c1-5(9)10-2-6(13)11-3-7(14)12-4-8(15)16/h10H,1-4,9H2,(H,11,13)(H,12,14)(H,15,16) |
| InChIKey | XUUBEKBFLJUBPR-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |