C8H14N3O5PS — CID 59692232
2-[[2-[[2-[(2-phosphanylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetic acid (PubChem CID 59692232) has the molecular formula C8H14N3O5PS and a molecular weight of 295.26 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-phosphanylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[(2-phosphanylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 59692232 |
| Molecular Formula | C8H14N3O5PS |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-[[2-[[2-[(2-phosphanylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CNC(=O)CNC(=O)CSP |
| InChI | InChI=1S/C8H14N3O5PS/c12-5(2-10-7(14)4-18-17)9-1-6(13)11-3-8(15)16/h1-4,17H2,(H,9,12)(H,10,14)(H,11,13)(H,15,16) |
| InChIKey | QQKNDMMLJUWVAO-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|