C6H12N4O3 — CID 43315738
N-(2-aminoethyl)-N'-(2-amino-2-oxoethyl)oxamide (PubChem CID 43315738) has the molecular formula C6H12N4O3 and a molecular weight of 188.19 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-(2-amino-2-oxoethyl)oxamide.
| Compound Name | N-(2-aminoethyl)-N'-(2-amino-2-oxoethyl)oxamide |
|---|---|
| PubChem CID | 43315738 |
| Molecular Formula | C6H12N4O3 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | N-(2-aminoethyl)-N'-(2-amino-2-oxoethyl)oxamide |
| SMILES | NCCNC(=O)C(=O)NCC(N)=O |
| InChI | InChI=1S/C6H12N4O3/c7-1-2-9-5(12)6(13)10-3-4(8)11/h1-3,7H2,(H2,8,11)(H,9,12)(H,10,13) |
| InChIKey | SMQRASFMRAGUCN-UHFFFAOYSA-N |
| XLogP | -3.34 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|