C10H21N3O2 — CID 103460009
N-(2-aminoethyl)-N'-(2,2-dimethylbutyl)oxamide (PubChem CID 103460009) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-(2,2-dimethylbutyl)oxamide.
| Compound Name | N-(2-aminoethyl)-N'-(2,2-dimethylbutyl)oxamide |
|---|---|
| PubChem CID | 103460009 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | N-(2-aminoethyl)-N'-(2,2-dimethylbutyl)oxamide |
| SMILES | CCC(C)(C)CNC(=O)C(=O)NCCN |
| InChI | InChI=1S/C10H21N3O2/c1-4-10(2,3)7-13-9(15)8(14)12-6-5-11/h4-7,11H2,1-3H3,(H,12,14)(H,13,15) |
| InChIKey | MZIIVWNOODOMCA-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|