C7H12N2O — CID 174483011
N-(4-aminobut-3-enyl)prop-2-enamide (PubChem CID 174483011) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is N-(4-aminobut-3-enyl)prop-2-enamide.
| Compound Name | N-(4-aminobut-3-enyl)prop-2-enamide |
|---|---|
| PubChem CID | 174483011 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | N-(4-aminobut-3-enyl)prop-2-enamide |
| SMILES | C=CC(=O)NCCC=CN |
| InChI | InChI=1S/C7H12N2O/c1-2-7(10)9-6-4-3-5-8/h2-3,5H,1,4,6,8H2,(H,9,10) |
| InChIKey | QSPNAVOSQIYCJD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|