C7H9NO6 — CID 135376511
2-hydroxy-2-(prop-2-enoylamino)butanedioic acid (PubChem CID 135376511) has the molecular formula C7H9NO6 and a molecular weight of 203.15 g/mol. Its IUPAC name is 2-hydroxy-2-(prop-2-enoylamino)butanedioic acid.
| Compound Name | 2-hydroxy-2-(prop-2-enoylamino)butanedioic acid |
|---|---|
| PubChem CID | 135376511 |
| Molecular Formula | C7H9NO6 |
| Molecular Weight | 203.15 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 2-hydroxy-2-(prop-2-enoylamino)butanedioic acid |
| SMILES | C=CC(=O)NC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H9NO6/c1-2-4(9)8-7(14,6(12)13)3-5(10)11/h2,14H,1,3H2,(H,8,9)(H,10,11)(H,12,13) |
| InChIKey | NBWXIFIOIBSIHG-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.15 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|