C9H11NO8 — CID 151381961
2-hydroxy-1-(prop-2-enoylamino)propane-1,2,3-tricarboxylic acid (PubChem CID 151381961) has the molecular formula C9H11NO8 and a molecular weight of 261.19 g/mol. Its IUPAC name is 2-hydroxy-1-(prop-2-enoylamino)propane-1,2,3-tricarboxylic acid.
| Compound Name | 2-hydroxy-1-(prop-2-enoylamino)propane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 151381961 |
| Molecular Formula | C9H11NO8 |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 2-hydroxy-1-(prop-2-enoylamino)propane-1,2,3-tricarboxylic acid |
| SMILES | C=CC(=O)NC(C(=O)O)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H11NO8/c1-2-4(11)10-6(7(14)15)9(18,8(16)17)3-5(12)13/h2,6,18H,1,3H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17) |
| InChIKey | OSPHASAVHILLBA-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|