C7H8O10 — CID 87350226
1-carboxyoxy-2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 87350226) has the molecular formula C7H8O10 and a molecular weight of 252.13 g/mol. Its IUPAC name is 1-carboxyoxy-2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 1-carboxyoxy-2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87350226 |
| Molecular Formula | C7H8O10 |
| Molecular Weight | 252.13 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 1-carboxyoxy-2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)(C(=O)O)C(OC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H8O10/c8-2(9)1-7(16,5(12)13)3(4(10)11)17-6(14)15/h3,16H,1H2,(H,8,9)(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | GKAONRBYIGLOOS-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.13 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |