C28H25ClO8 — CID 91330057
1-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]-2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 91330057) has the molecular formula C28H25ClO8 and a molecular weight of 524.95 g/mol. Its IUPAC name is 1-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]-2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 1-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]-2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 91330057 |
| Molecular Formula | C28H25ClO8 |
| Molecular Weight | 524.95 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 1-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]-2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)(C(=O)O)C(Oc1ccc(C(=C(CCCl)c2ccccc2)c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C28H25ClO8/c29-16-15-22(18-7-3-1-4-8-18)24(19-9-5-2-6-10-19)20-11-13-21(14-12-20)37-25(26(32)33)28(36,27(34)35)17-23(30)31/h1-14,25,36H,15-17H2,(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | CAOYPWVWFOCHPS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.95 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|