C24H23ClOS — CID 59070243
2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenyl]sulfanylethanol (PubChem CID 59070243) has the molecular formula C24H23ClOS and a molecular weight of 394.97 g/mol. Its IUPAC name is 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenyl]sulfanylethanol.
| Compound Name | 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenyl]sulfanylethanol |
|---|---|
| PubChem CID | 59070243 |
| Molecular Formula | C24H23ClOS |
| Molecular Weight | 394.97 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenyl]sulfanylethanol |
| SMILES | OCCSc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23ClOS/c25-16-15-23(19-7-3-1-4-8-19)24(20-9-5-2-6-10-20)21-11-13-22(14-12-21)27-18-17-26/h1-14,26H,15-18H2/b24-23- |
| InChIKey | BHNDRXNBYHXZQX-VHXPQNKSSA-N |
| XLogP | 6.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.97 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|