C13H18O11 — CID 87385740
2-[1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)oxy-1-oxobutan-2-yl]-2-hydroxybutanedioic acid (PubChem CID 87385740) has the molecular formula C13H18O11 and a molecular weight of 350.28 g/mol. Its IUPAC name is 2-[1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)oxy-1-oxobutan-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)oxy-1-oxobutan-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 87385740 |
| Molecular Formula | C13H18O11 |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 2-[1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)oxy-1-oxobutan-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCC(C(=O)OC(C(=O)OC)C(=O)OC)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H18O11/c1-4-6(13(21,12(19)20)5-7(14)15)9(16)24-8(10(17)22-2)11(18)23-3/h6,8,21H,4-5H2,1-3H3,(H,14,15)(H,19,20) |
| InChIKey | QBQCVEWXOGRHED-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 173.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|