C16H22N2O15 — CID 54200980
4,5-bis[bis(carboxymethyl)amino]-2-hydroxypentane-1,2,3-tricarboxylic acid (PubChem CID 54200980) has the molecular formula C16H22N2O15 and a molecular weight of 482.35 g/mol. Its IUPAC name is 4,5-bis[bis(carboxymethyl)amino]-2-hydroxypentane-1,2,3-tricarboxylic acid.
| Compound Name | 4,5-bis[bis(carboxymethyl)amino]-2-hydroxypentane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 54200980 |
| Molecular Formula | C16H22N2O15 |
| Molecular Weight | 482.35 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 4,5-bis[bis(carboxymethyl)amino]-2-hydroxypentane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CN(CC(=O)O)CC(C(C(=O)O)C(O)(CC(=O)O)C(=O)O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C16H22N2O15/c19-8(20)1-16(33,15(31)32)13(14(29)30)7(18(5-11(25)26)6-12(27)28)2-17(3-9(21)22)4-10(23)24/h7,13,33H,1-6H2,(H,19,20)(H,21,22)(H,23,24)(H,25,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | PPFGHXBEKZYKBE-UHFFFAOYSA-N |
| XLogP | -3.71 |
| TPSA | 287.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.35 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |