C10H16N2O11S — CID 57121956
2-[[2-[bis(carboxymethyl)amino]-2-sulfinooxyethyl]-(carboxymethyl)amino]acetic acid (PubChem CID 57121956) has the molecular formula C10H16N2O11S and a molecular weight of 372.31 g/mol. Its IUPAC name is 2-[[2-[bis(carboxymethyl)amino]-2-sulfinooxyethyl]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[2-[bis(carboxymethyl)amino]-2-sulfinooxyethyl]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 57121956 |
| Molecular Formula | C10H16N2O11S |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 2-[[2-[bis(carboxymethyl)amino]-2-sulfinooxyethyl]-(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)CC(OS(=O)O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H16N2O11S/c13-7(14)2-11(3-8(15)16)1-6(23-24(21)22)12(4-9(17)18)5-10(19)20/h6H,1-5H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | POGYAGQAXWWPEC-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 202.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|