C10H19N2Na3O17S3 — CID 162253415
trisodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;hydrogen sulfite (PubChem CID 162253415) has the molecular formula C10H19N2Na3O17S3 and a molecular weight of 604.43 g/mol. Its IUPAC name is trisodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;hydrogen sulfite.
| Compound Name | trisodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;hydrogen sulfite |
|---|---|
| PubChem CID | 162253415 |
| Molecular Formula | C10H19N2Na3O17S3 |
| Molecular Weight | 604.43 g/mol |
| Exact Mass | 603.95 |
| IUPAC Name | trisodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;hydrogen sulfite |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.O=S([O-])O.O=S([O-])O.O=S([O-])O.[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C10H16N2O8.3Na.3H2O3S/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;3*1-4(2)3/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;;3*(H2,1,2,3)/q;3*+1;;;/p-3 |
| InChIKey | KFEWZYKXLAHYQD-UHFFFAOYSA-K |
| XLogP | -13.04 |
| TPSA | 336.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.43 |
| LogP ≤ 5 | -13.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|