C8H11NO — CID 156540432
(2Z)-2-ethenylhexa-2,5-dienamide (PubChem CID 156540432) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is (2Z)-2-ethenylhexa-2,5-dienamide.
| Compound Name | (2Z)-2-ethenylhexa-2,5-dienamide |
|---|---|
| PubChem CID | 156540432 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (2Z)-2-ethenylhexa-2,5-dienamide |
| SMILES | C=CC/C=C(/C=C)C(N)=O |
| InChI | InChI=1S/C8H11NO/c1-3-5-6-7(4-2)8(9)10/h3-4,6H,1-2,5H2,(H2,9,10)/b7-6- |
| InChIKey | MCEVZUIALNSZRG-SREVYHEPSA-N |
| XLogP | 1.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|