C9H15N3O2 — CID 57408506
(2S,5S)-1-prop-2-enylpyrrolidine-2,5-dicarboxamide (PubChem CID 57408506) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is (2S,5S)-1-prop-2-enylpyrrolidine-2,5-dicarboxamide.
| Compound Name | (2S,5S)-1-prop-2-enylpyrrolidine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 57408506 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (2S,5S)-1-prop-2-enylpyrrolidine-2,5-dicarboxamide |
| SMILES | C=CCN1[C@H](C(N)=O)CC[C@H]1C(N)=O |
| InChI | InChI=1S/C9H15N3O2/c1-2-5-12-6(8(10)13)3-4-7(12)9(11)14/h2,6-7H,1,3-5H2,(H2,10,13)(H2,11,14)/t6-,7-/m0/s1 |
| InChIKey | SUPQHMUCDICZSK-BQBZGAKWSA-N |
| XLogP | -1.02 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|