C12H14N2O2 — CID 8834015
(2S)-4-prop-2-enyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 8834015) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (2S)-4-prop-2-enyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2S)-4-prop-2-enyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 8834015 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (2S)-4-prop-2-enyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | C=CCN1C[C@@H](C(N)=O)Oc2ccccc21 |
| InChI | InChI=1S/C12H14N2O2/c1-2-7-14-8-11(12(13)15)16-10-6-4-3-5-9(10)14/h2-6,11H,1,7-8H2,(H2,13,15)/t11-/m0/s1 |
| InChIKey | KMUQDOYYTLERCO-NSHDSACASA-N |
| XLogP | 0.93 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|