C12H12N2O3 — CID 129365095
(2S)-4-prop-2-enoyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 129365095) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is (2S)-4-prop-2-enoyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2S)-4-prop-2-enoyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 129365095 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | (2S)-4-prop-2-enoyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | C=CC(=O)N1C[C@@H](C(N)=O)Oc2ccccc21 |
| InChI | InChI=1S/C12H12N2O3/c1-2-11(15)14-7-10(12(13)16)17-9-6-4-3-5-8(9)14/h2-6,10H,1,7H2,(H2,13,16)/t10-/m0/s1 |
| InChIKey | FCQAMPRDHSNSNU-JTQLQIEISA-N |
| XLogP | 0.45 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|