C10H13NO — CID 175339365
2-buta-2,3-dienylhexa-2,5-dienamide (PubChem CID 175339365) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-buta-2,3-dienylhexa-2,5-dienamide.
| Compound Name | 2-buta-2,3-dienylhexa-2,5-dienamide |
|---|---|
| PubChem CID | 175339365 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2-buta-2,3-dienylhexa-2,5-dienamide |
| SMILES | C=C=CCC(=CCC=C)C(N)=O |
| InChI | InChI=1S/C10H13NO/c1-3-5-7-9(10(11)12)8-6-4-2/h3,6-7H,1-2,5,8H2,(H2,11,12) |
| InChIKey | AWSWQUBHQHNYEF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|