C11H14N2O — CID 142229752
(2E)-6-cyano-2-ethylocta-2,5,7-trienamide (PubChem CID 142229752) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is (2E)-6-cyano-2-ethylocta-2,5,7-trienamide.
| Compound Name | (2E)-6-cyano-2-ethylocta-2,5,7-trienamide |
|---|---|
| PubChem CID | 142229752 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (2E)-6-cyano-2-ethylocta-2,5,7-trienamide |
| SMILES | C=CC(C#N)=CC/C=C(\CC)C(N)=O |
| InChI | InChI=1S/C11H14N2O/c1-3-9(8-12)6-5-7-10(4-2)11(13)14/h3,6-7H,1,4-5H2,2H3,(H2,13,14)/b9-6?,10-7+ |
| InChIKey | LEFUNUHTXKHGJM-RCXDVQKISA-N |
| XLogP | 1.83 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|