C11H16N2O — CID 123403650
N-(4-cyanohexa-3,5-dien-2-yl)butanamide (PubChem CID 123403650) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is N-(4-cyanohexa-3,5-dien-2-yl)butanamide.
| Compound Name | N-(4-cyanohexa-3,5-dien-2-yl)butanamide |
|---|---|
| PubChem CID | 123403650 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N-(4-cyanohexa-3,5-dien-2-yl)butanamide |
| SMILES | C=CC(C#N)=CC(C)NC(=O)CCC |
| InChI | InChI=1S/C11H16N2O/c1-4-6-11(14)13-9(3)7-10(5-2)8-12/h5,7,9H,2,4,6H2,1,3H3,(H,13,14) |
| InChIKey | NKRRJKOCGKFAHD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|