C12H19NO — CID 89153831
(2E,4E)-2-ethenyl-5-methylnona-2,4-dienamide (PubChem CID 89153831) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-5-methylnona-2,4-dienamide.
| Compound Name | (2E,4E)-2-ethenyl-5-methylnona-2,4-dienamide |
|---|---|
| PubChem CID | 89153831 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (2E,4E)-2-ethenyl-5-methylnona-2,4-dienamide |
| SMILES | C=C/C(=C\C=C(/C)CCCC)C(N)=O |
| InChI | InChI=1S/C12H19NO/c1-4-6-7-10(3)8-9-11(5-2)12(13)14/h5,8-9H,2,4,6-7H2,1,3H3,(H2,13,14)/b10-8+,11-9+ |
| InChIKey | DKFLKXMJDBFTKF-GFULKKFKSA-N |
| XLogP | 2.72 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|