C15H23NO — CID 130460991
(2E,4E)-5-cyclohexyl-2-ethenylhepta-2,4-dienamide (PubChem CID 130460991) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is (2E,4E)-5-cyclohexyl-2-ethenylhepta-2,4-dienamide.
| Compound Name | (2E,4E)-5-cyclohexyl-2-ethenylhepta-2,4-dienamide |
|---|---|
| PubChem CID | 130460991 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (2E,4E)-5-cyclohexyl-2-ethenylhepta-2,4-dienamide |
| SMILES | C=C/C(=C\C=C(/CC)C1CCCCC1)C(N)=O |
| InChI | InChI=1S/C15H23NO/c1-3-12(14-8-6-5-7-9-14)10-11-13(4-2)15(16)17/h4,10-11,14H,2-3,5-9H2,1H3,(H2,16,17)/b12-10+,13-11+ |
| InChIKey | XUFYWDDWAZCXER-DCIPZJNNSA-N |
| XLogP | 3.50 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|