C14H24 — CID 142840542
[(3E)-6-methylhepta-3,5-dien-3-yl]cyclohexane (PubChem CID 142840542) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is [(3E)-6-methylhepta-3,5-dien-3-yl]cyclohexane.
| Compound Name | [(3E)-6-methylhepta-3,5-dien-3-yl]cyclohexane |
|---|---|
| PubChem CID | 142840542 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | [(3E)-6-methylhepta-3,5-dien-3-yl]cyclohexane |
| SMILES | CC/C(=C\C=C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C14H24/c1-4-13(11-10-12(2)3)14-8-6-5-7-9-14/h10-11,14H,4-9H2,1-3H3/b13-11+ |
| InChIKey | WTLOHSHXOYGNKX-ACCUITESSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|