C11H15Cl — CID 123269942
6-chloroocta-3,5,7-trien-3-ylcyclopropane (PubChem CID 123269942) has the molecular formula C11H15Cl and a molecular weight of 182.69 g/mol. Its IUPAC name is 6-chloroocta-3,5,7-trien-3-ylcyclopropane.
| Compound Name | 6-chloroocta-3,5,7-trien-3-ylcyclopropane |
|---|---|
| PubChem CID | 123269942 |
| Molecular Formula | C11H15Cl |
| Molecular Weight | 182.69 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 6-chloroocta-3,5,7-trien-3-ylcyclopropane |
| SMILES | C=CC(Cl)=CC=C(CC)C1CC1 |
| InChI | InChI=1S/C11H15Cl/c1-3-9(10-5-6-10)7-8-11(12)4-2/h4,7-8,10H,2-3,5-6H2,1H3 |
| InChIKey | UFHOPFXMOXUGSC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.69 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|