C9H12 — CID 142446147
[(3E)-hexa-1,3,5-trien-3-yl]cyclopropane (PubChem CID 142446147) has the molecular formula C9H12 and a molecular weight of 120.19 g/mol. Its IUPAC name is [(3E)-hexa-1,3,5-trien-3-yl]cyclopropane.
| Compound Name | [(3E)-hexa-1,3,5-trien-3-yl]cyclopropane |
|---|---|
| PubChem CID | 142446147 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | [(3E)-hexa-1,3,5-trien-3-yl]cyclopropane |
| SMILES | C=C/C=C(\C=C)C1CC1 |
| InChI | InChI=1S/C9H12/c1-3-5-8(4-2)9-6-7-9/h3-5,9H,1-2,6-7H2/b8-5+ |
| InChIKey | NRSKRRGZXNTINZ-VMPITWQZSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|