About [(3E)-hexa-1,3,5-trien-3-yl]cyclopropane
[(3E)-hexa-1,3,5-trien-3-yl]cyclopropane (PubChem CID 142446147) has the molecular formula C9H12
and a molecular weight of 120.19 g/mol. Its IUPAC name is [(3E)-hexa-1,3,5-trien-3-yl]cyclopropane.
Molecular Properties
| Compound Name | [(3E)-hexa-1,3,5-trien-3-yl]cyclopropane |
| PubChem CID | 142446147 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | [(3E)-hexa-1,3,5-trien-3-yl]cyclopropane |
| SMILES | C=C/C=C(\C=C)C1CC1 |
| InChI | InChI=1S/C9H12/c1-3-5-8(4-2)9-6-7-9/h3-5,9H,1-2,6-7H2/b8-5+ |
| InChIKey | NRSKRRGZXNTINZ-VMPITWQZSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3E)-hexa-1,3,5-trien-3-yl]cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E)-hexa-1,3,5-trien-3-yl]cyclopropane?
The IUPAC name of [(3E)-hexa-1,3,5-trien-3-yl]cyclopropane (CID 142446147) is [(3E)-hexa-1,3,5-trien-3-yl]cyclopropane.
What is the SMILES notation for [(3E)-hexa-1,3,5-trien-3-yl]cyclopropane?
The canonical SMILES for [(3E)-hexa-1,3,5-trien-3-yl]cyclopropane is C=C/C=C(\C=C)C1CC1.
What is the InChIKey of [(3E)-hexa-1,3,5-trien-3-yl]cyclopropane?
The InChIKey is NRSKRRGZXNTINZ-VMPITWQZSA-N. The full InChI is InChI=1S/C9H12/c1-3-5-8(4-2)9-6-7-9/h3-5,9H,1-2,6-7H2/b8-5+.
What are the key properties of [(3E)-hexa-1,3,5-trien-3-yl]cyclopropane?
[(3E)-hexa-1,3,5-trien-3-yl]cyclopropane has a molecular weight of 120.19 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-hexa-1,3,5-trien-3-yl]cyclopropane is sourced from PubChem (CID 142446147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).