About 1-cyclopropylbuta-1,3-dienylcyclopropane
1-cyclopropylbuta-1,3-dienylcyclopropane (PubChem CID 12578306) has the molecular formula C10H14
and a molecular weight of 134.22 g/mol. Its IUPAC name is 1-cyclopropylbuta-1,3-dienylcyclopropane.
Molecular Properties
| Compound Name | 1-cyclopropylbuta-1,3-dienylcyclopropane |
| PubChem CID | 12578306 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 1-cyclopropylbuta-1,3-dienylcyclopropane |
| SMILES | C=CC=C(C1CC1)C1CC1 |
| InChI | InChI=1S/C10H14/c1-2-3-10(8-4-5-8)9-6-7-9/h2-3,8-9H,1,4-7H2 |
| InChIKey | HYOVDFQNDBDJJD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropylbuta-1,3-dienylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylbuta-1,3-dienylcyclopropane?
The IUPAC name of 1-cyclopropylbuta-1,3-dienylcyclopropane (CID 12578306) is 1-cyclopropylbuta-1,3-dienylcyclopropane.
What is the SMILES notation for 1-cyclopropylbuta-1,3-dienylcyclopropane?
The canonical SMILES for 1-cyclopropylbuta-1,3-dienylcyclopropane is C=CC=C(C1CC1)C1CC1.
What is the InChIKey of 1-cyclopropylbuta-1,3-dienylcyclopropane?
The InChIKey is HYOVDFQNDBDJJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14/c1-2-3-10(8-4-5-8)9-6-7-9/h2-3,8-9H,1,4-7H2.
What are the key properties of 1-cyclopropylbuta-1,3-dienylcyclopropane?
1-cyclopropylbuta-1,3-dienylcyclopropane has a molecular weight of 134.22 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylbuta-1,3-dienylcyclopropane is sourced from PubChem (CID 12578306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).