C9H14 — CID 13014702
[(3E)-hexa-3,5-dien-3-yl]cyclopropane (PubChem CID 13014702) has the molecular formula C9H14 and a molecular weight of 122.21 g/mol. Its IUPAC name is [(3E)-hexa-3,5-dien-3-yl]cyclopropane.
| Compound Name | [(3E)-hexa-3,5-dien-3-yl]cyclopropane |
|---|---|
| PubChem CID | 13014702 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | [(3E)-hexa-3,5-dien-3-yl]cyclopropane |
| SMILES | C=C/C=C(\CC)C1CC1 |
| InChI | InChI=1S/C9H14/c1-3-5-8(4-2)9-6-7-9/h3,5,9H,1,4,6-7H2,2H3/b8-5+ |
| InChIKey | BUYOWVXIPMTRDQ-VMPITWQZSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|