About 2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane
2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane (PubChem CID 156863517) has the molecular formula C18H35N
and a molecular weight of 265.49 g/mol. Its IUPAC name is 2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane.
Molecular Properties
| Compound Name | 2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane |
| PubChem CID | 156863517 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.49 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | 2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane |
| SMILES | C=C/C=C(\CC)CN1C(CC)CCCC1CC.CC |
| InChI | InChI=1S/C16H29N.C2H6/c1-5-10-14(6-2)13-17-15(7-3)11-9-12-16(17)8-4;1-2/h5,10,15-16H,1,6-9,11-13H2,2-4H3;1-2H3/b14-10+; |
| InChIKey | FKZLLMQCCNHEBF-KMZJGFRYSA-N |
| XLogP | 5.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane?
The IUPAC name of 2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane (CID 156863517) is 2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane.
What is the SMILES notation for 2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane?
The canonical SMILES for 2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane is C=C/C=C(\CC)CN1C(CC)CCCC1CC.CC.
What is the InChIKey of 2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane?
The InChIKey is FKZLLMQCCNHEBF-KMZJGFRYSA-N. The full InChI is InChI=1S/C16H29N.C2H6/c1-5-10-14(6-2)13-17-15(7-3)11-9-12-16(17)8-4;1-2/h5,10,15-16H,1,6-9,11-13H2,2-4H3;1-2H3/b14-10+;.
What are the key properties of 2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane?
2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane has a molecular weight of 265.49 g/mol, XLogP of 5.58, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane is sourced from PubChem (CID 156863517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).