C18H35N — CID 156863517
2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane (PubChem CID 156863517) has the molecular formula C18H35N and a molecular weight of 265.49 g/mol. Its IUPAC name is 2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane.
| Compound Name | 2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane |
|---|---|
| PubChem CID | 156863517 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.49 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | 2,6-diethyl-1-[(2E)-2-ethylpenta-2,4-dienyl]piperidine;ethane |
| SMILES | C=C/C=C(\CC)CN1C(CC)CCCC1CC.CC |
| InChI | InChI=1S/C16H29N.C2H6/c1-5-10-14(6-2)13-17-15(7-3)11-9-12-16(17)8-4;1-2/h5,10,15-16H,1,6-9,11-13H2,2-4H3;1-2H3/b14-10+; |
| InChIKey | FKZLLMQCCNHEBF-KMZJGFRYSA-N |
| XLogP | 5.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|