C13H23N — CID 144806712
1-[(2E)-2-propylpenta-2,4-dienyl]piperidine (PubChem CID 144806712) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 1-[(2E)-2-propylpenta-2,4-dienyl]piperidine.
| Compound Name | 1-[(2E)-2-propylpenta-2,4-dienyl]piperidine |
|---|---|
| PubChem CID | 144806712 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 1-[(2E)-2-propylpenta-2,4-dienyl]piperidine |
| SMILES | C=C/C=C(\CCC)CN1CCCCC1 |
| InChI | InChI=1S/C13H23N/c1-3-8-13(9-4-2)12-14-10-6-5-7-11-14/h3,8H,1,4-7,9-12H2,2H3/b13-8+ |
| InChIKey | WJJNKKVILWKKCZ-MDWZMJQESA-N |
| XLogP | 3.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|