C20H30O2 — CID 143963194
[(2Z)-1-methoxy-4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]oxypenta-2,4-dien-2-yl]cyclohexane (PubChem CID 143963194) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is [(2Z)-1-methoxy-4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]oxypenta-2,4-dien-2-yl]cyclohexane.
| Compound Name | [(2Z)-1-methoxy-4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]oxypenta-2,4-dien-2-yl]cyclohexane |
|---|---|
| PubChem CID | 143963194 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | [(2Z)-1-methoxy-4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]oxypenta-2,4-dien-2-yl]cyclohexane |
| SMILES | C=C/C=C(\C=C(C)C)OC(=C)/C=C(\COC)C1CCCCC1 |
| InChI | InChI=1S/C20H30O2/c1-6-10-20(13-16(2)3)22-17(4)14-19(15-21-5)18-11-8-7-9-12-18/h6,10,13-14,18H,1,4,7-9,11-12,15H2,2-3,5H3/b19-14+,20-10+ |
| InChIKey | RCXPXOIYQGMHLV-AIIDXRDLSA-N |
| XLogP | 5.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|