C29H48O2 — CID 143963193
[(2Z)-1-methoxy-4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]oxypenta-2,4-dien-2-yl]cyclohexane;propan-2-ylcyclohexane (PubChem CID 143963193) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is [(2Z)-1-methoxy-4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]oxypenta-2,4-dien-2-yl]cyclohexane;propan-2-ylcyclohexane.
| Compound Name | [(2Z)-1-methoxy-4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]oxypenta-2,4-dien-2-yl]cyclohexane;propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 143963193 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | [(2Z)-1-methoxy-4-[(3E)-6-methylhepta-1,3,5-trien-4-yl]oxypenta-2,4-dien-2-yl]cyclohexane;propan-2-ylcyclohexane |
| SMILES | C=C/C=C(\C=C(C)C)OC(=C)/C=C(\COC)C1CCCCC1.CC(C)C1CCCCC1 |
| InChI | InChI=1S/C20H30O2.C9H18/c1-6-10-20(13-16(2)3)22-17(4)14-19(15-21-5)18-11-8-7-9-12-18;1-8(2)9-6-4-3-5-7-9/h6,10,13-14,18H,1,4,7-9,11-12,15H2,2-3,5H3;8-9H,3-7H2,1-2H3/b19-14+,20-10+; |
| InChIKey | RPRBSUNLRWNZEO-IDXASULDSA-N |
| XLogP | 8.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|