C18H23NO2 — CID 154687185
3-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylcyclobutan-1-amine;phenyl formate (PubChem CID 154687185) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylcyclobutan-1-amine;phenyl formate.
| Compound Name | 3-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylcyclobutan-1-amine;phenyl formate |
|---|---|
| PubChem CID | 154687185 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylcyclobutan-1-amine;phenyl formate |
| SMILES | C=C/C=C(\C=C)C1CC(NC)C1.O=COc1ccccc1 |
| InChI | InChI=1S/C11H17N.C7H6O2/c1-4-6-9(5-2)10-7-11(8-10)12-3;8-6-9-7-4-2-1-3-5-7/h4-6,10-12H,1-2,7-8H2,3H3;1-6H/b9-6+; |
| InChIKey | KFWPOJJPAONERI-MLBSPLJJSA-N |
| XLogP | 3.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|