C14H18O2 — CID 143422244
ethane;(3E)-3-phenoxyhexa-1,3,5-trien-2-ol (PubChem CID 143422244) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is ethane;(3E)-3-phenoxyhexa-1,3,5-trien-2-ol.
| Compound Name | ethane;(3E)-3-phenoxyhexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 143422244 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | ethane;(3E)-3-phenoxyhexa-1,3,5-trien-2-ol |
| SMILES | C=C/C=C(/Oc1ccccc1)C(=C)O.CC |
| InChI | InChI=1S/C12H12O2.C2H6/c1-3-7-12(10(2)13)14-11-8-5-4-6-9-11;1-2/h3-9,13H,1-2H2;1-2H3/b12-7+; |
| InChIKey | XIUKHHRNLRFLTO-RRAJOLSVSA-N |
| XLogP | 4.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|