C17H26O — CID 143117952
ethane;[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxybenzene (PubChem CID 143117952) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is ethane;[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxybenzene.
| Compound Name | ethane;[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxybenzene |
|---|---|
| PubChem CID | 143117952 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | ethane;[(2E,4Z)-hepta-2,4,6-trien-2-yl]oxybenzene |
| SMILES | C=C/C=C\C=C(/C)Oc1ccccc1.CC.CC |
| InChI | InChI=1S/C13H14O.2C2H6/c1-3-4-6-9-12(2)14-13-10-7-5-8-11-13;2*1-2/h3-11H,1H2,2H3;2*1-2H3/b6-4-,12-9+;; |
| InChIKey | YQYUHOVFWFLUPZ-QHTPEIRWSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|