About bicyclo[2.2.1]hept-2-ene;methyl prop-2-enoate;styrene
bicyclo[2.2.1]hept-2-ene;methyl prop-2-enoate;styrene (PubChem CID 86604939) has the molecular formula C19H24O2
and a molecular weight of 284.40 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;methyl prop-2-enoate;styrene.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-2-ene;methyl prop-2-enoate;styrene |
| PubChem CID | 86604939 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;methyl prop-2-enoate;styrene |
| SMILES | C1=CC2CCC1C2.C=CC(=O)OC.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C7H10.C4H6O2/c1-2-8-6-4-3-5-7-8;1-2-7-4-3-6(1)5-7;1-3-4(5)6-2/h2-7H,1H2;1-2,6-7H,3-5H2;3H,1H2,2H3 |
| InChIKey | LAQVFXCPUCCCHV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-2-ene;methyl prop-2-enoate;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-2-ene;methyl prop-2-enoate;styrene?
The IUPAC name of bicyclo[2.2.1]hept-2-ene;methyl prop-2-enoate;styrene (CID 86604939) is bicyclo[2.2.1]hept-2-ene;methyl prop-2-enoate;styrene.
What is the SMILES notation for bicyclo[2.2.1]hept-2-ene;methyl prop-2-enoate;styrene?
The canonical SMILES for bicyclo[2.2.1]hept-2-ene;methyl prop-2-enoate;styrene is C1=CC2CCC1C2.C=CC(=O)OC.C=Cc1ccccc1.
What is the InChIKey of bicyclo[2.2.1]hept-2-ene;methyl prop-2-enoate;styrene?
The InChIKey is LAQVFXCPUCCCHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C7H10.C4H6O2/c1-2-8-6-4-3-5-7-8;1-2-7-4-3-6(1)5-7;1-3-4(5)6-2/h2-7H,1H2;1-2,6-7H,3-5H2;3H,1H2,2H3.
What are the key properties of bicyclo[2.2.1]hept-2-ene;methyl prop-2-enoate;styrene?
bicyclo[2.2.1]hept-2-ene;methyl prop-2-enoate;styrene has a molecular weight of 284.40 g/mol, XLogP of 4.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-2-ene;methyl prop-2-enoate;styrene is sourced from PubChem (CID 86604939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).