C11H12O3 — CID 142948729
5-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylidene-1,4-dioxan-2-one (PubChem CID 142948729) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 5-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylidene-1,4-dioxan-2-one.
| Compound Name | 5-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylidene-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 142948729 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 5-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylidene-1,4-dioxan-2-one |
| SMILES | C=C/C=C(\C=C)C1COC(=O)C(=C)O1 |
| InChI | InChI=1S/C11H12O3/c1-4-6-9(5-2)10-7-13-11(12)8(3)14-10/h4-6,10H,1-3,7H2/b9-6+ |
| InChIKey | ZUWXHSVNXZVPSK-RMKNXTFCSA-N |
| XLogP | 1.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|