C5H7NO3 — CID 134839324
4-ethenyl-3-hydroxy-1,3-oxazolidin-2-one (PubChem CID 134839324) has the molecular formula C5H7NO3 and a molecular weight of 129.11 g/mol. Its IUPAC name is 4-ethenyl-3-hydroxy-1,3-oxazolidin-2-one.
| Compound Name | 4-ethenyl-3-hydroxy-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134839324 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | 4-ethenyl-3-hydroxy-1,3-oxazolidin-2-one |
| SMILES | C=CC1COC(=O)N1O |
| InChI | InChI=1S/C5H7NO3/c1-2-4-3-9-5(7)6(4)8/h2,4,8H,1,3H2 |
| InChIKey | QYPBLDHUJPEALN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|