C9H15NO3 — CID 117011129
5-(2-hydroxyethyl)-3-prop-2-enyl-1,3-oxazinan-2-one (PubChem CID 117011129) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-3-prop-2-enyl-1,3-oxazinan-2-one.
| Compound Name | 5-(2-hydroxyethyl)-3-prop-2-enyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 117011129 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 5-(2-hydroxyethyl)-3-prop-2-enyl-1,3-oxazinan-2-one |
| SMILES | C=CCN1CC(CCO)COC1=O |
| InChI | InChI=1S/C9H15NO3/c1-2-4-10-6-8(3-5-11)7-13-9(10)12/h2,8,11H,1,3-7H2 |
| InChIKey | XTTYBOIRYVTISJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|